C25H29NO2 — CID 70686080
(8S,9S,10R,13S,14S,17E)-4-hydroxy-10,13-dimethyl-17-(pyridin-2-ylmethylidene)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 70686080) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17E)-4-hydroxy-10,13-dimethyl-17-(pyridin-2-ylmethylidene)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17E)-4-hydroxy-10,13-dimethyl-17-(pyridin-2-ylmethylidene)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70686080 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,17E)-4-hydroxy-10,13-dimethyl-17-(pyridin-2-ylmethylidene)-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C(O)=C1C=C[C@@H]1[C@@H]2CC[C@]2(C)/C(=C/c3ccccn3)CC[C@@H]12 |
| InChI | InChI=1S/C25H29NO2/c1-24-12-10-20-18(7-9-21-23(28)22(27)11-13-25(20,21)2)19(24)8-6-16(24)15-17-5-3-4-14-26-17/h3-5,7,9,14-15,18-20,28H,6,8,10-13H2,1-2H3/b16-15+/t18-,19-,20-,24+,25+/m0/s1 |
| InChIKey | YIACJDFVDKYMFS-ZSUFKLGASA-N |
| XLogP | 5.66 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |