About bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate
bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 70686084) has the molecular formula C27H23N7O4
and a molecular weight of 509.53 g/mol. Its IUPAC name is bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate.
Molecular Properties
| Compound Name | bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate |
| PubChem CID | 70686084 |
| Molecular Formula | C27H23N7O4 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | O=C(OCc1cn(Cc2ccccc2)nn1)c1cccc(C(=O)OCc2cn(Cc3ccccc3)nn2)n1 |
| InChI | InChI=1S/C27H23N7O4/c35-26(37-18-22-16-33(31-29-22)14-20-8-3-1-4-9-20)24-12-7-13-25(28-24)27(36)38-19-23-17-34(32-30-23)15-21-10-5-2-6-11-21/h1-13,16-17H,14-15,18-19H2 |
| InChIKey | ZNHJDCQDALYCQG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 126.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Analyze bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate?
The IUPAC name of bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate (CID 70686084) is bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate.
What is the SMILES notation for bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate?
The canonical SMILES for bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate is O=C(OCc1cn(Cc2ccccc2)nn1)c1cccc(C(=O)OCc2cn(Cc3ccccc3)nn2)n1.
What is the InChIKey of bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate?
The InChIKey is ZNHJDCQDALYCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23N7O4/c35-26(37-18-22-16-33(31-29-22)14-20-8-3-1-4-9-20)24-12-7-13-25(28-24)27(36)38-19-23-17-34(32-30-23)15-21-10-5-2-6-11-21/h1-13,16-17H,14-15,18-19H2.
What are the key properties of bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate?
bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate has a molecular weight of 509.53 g/mol, XLogP of 3.08, 10 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(1-benzyltriazol-4-yl)methyl] pyridine-2,6-dicarboxylate is sourced from PubChem (CID 70686084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).