C20H22N2O3 — CID 70686216
1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone (PubChem CID 70686216) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone.
| Compound Name | 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone |
|---|---|
| PubChem CID | 70686216 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(1R,3S,11R,15S)-6-hydroxy-16-oxa-4,14-diazahexacyclo[12.5.2.03,11.05,10.011,15.015,19]henicosa-5(10),6,8,18-tetraen-4-yl]ethanone |
| SMILES | CC(=O)N1c2c(O)cccc2[C@]23CCN4CC[C@H](C[C@H]12)C1=CCO[C@]143 |
| InChI | InChI=1S/C20H22N2O3/c1-12(23)22-17-11-13-5-8-21-9-7-19(17,20(21)14(13)6-10-25-20)15-3-2-4-16(24)18(15)22/h2-4,6,13,17,24H,5,7-11H2,1H3/t13-,17+,19-,20+/m1/s1 |
| InChIKey | FPEWLKWWYJYGBX-IQCLKLAJSA-N |
| XLogP | 2.15 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|