About 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol
2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol (PubChem CID 70686264) has the molecular formula C15H14FN3O2
and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol |
| PubChem CID | 70686264 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol |
| SMILES | Oc1ccc2nc(-c3ccc(NCCCF)nc3)oc2c1 |
| InChI | InChI=1S/C15H14FN3O2/c16-6-1-7-17-14-5-2-10(9-18-14)15-19-12-4-3-11(20)8-13(12)21-15/h2-5,8-9,20H,1,6-7H2,(H,17,18) |
| InChIKey | NTBQEXBGSJWFCC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol?
The IUPAC name of 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol (CID 70686264) is 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol.
What is the SMILES notation for 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol?
The canonical SMILES for 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol is Oc1ccc2nc(-c3ccc(NCCCF)nc3)oc2c1.
What is the InChIKey of 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol?
The InChIKey is NTBQEXBGSJWFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN3O2/c16-6-1-7-17-14-5-2-10(9-18-14)15-19-12-4-3-11(20)8-13(12)21-15/h2-5,8-9,20H,1,6-7H2,(H,17,18).
What are the key properties of 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol?
2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol has a molecular weight of 287.29 g/mol, XLogP of 3.37, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3-fluoropropylamino)-3-pyridinyl]-1,3-benzoxazol-6-ol is sourced from PubChem (CID 70686264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).