C30H36N2O4 — CID 70686323
ethyl 6-[3-[[propan-2-yl-(4-pyridin-4-ylbenzoyl)amino]methyl]phenoxy]hexanoate (PubChem CID 70686323) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is ethyl 6-[3-[[propan-2-yl-(4-pyridin-4-ylbenzoyl)amino]methyl]phenoxy]hexanoate.
| Compound Name | ethyl 6-[3-[[propan-2-yl-(4-pyridin-4-ylbenzoyl)amino]methyl]phenoxy]hexanoate |
|---|---|
| PubChem CID | 70686323 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | ethyl 6-[3-[[propan-2-yl-(4-pyridin-4-ylbenzoyl)amino]methyl]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cccc(CN(C(=O)c2ccc(-c3ccncc3)cc2)C(C)C)c1 |
| InChI | InChI=1S/C30H36N2O4/c1-4-35-29(33)11-6-5-7-20-36-28-10-8-9-24(21-28)22-32(23(2)3)30(34)27-14-12-25(13-15-27)26-16-18-31-19-17-26/h8-10,12-19,21,23H,4-7,11,20,22H2,1-3H3 |
| InChIKey | AFOGBOHCZCHWPJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|