About 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate
2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate (PubChem CID 70686348) has the molecular formula C13H15N3O8S2
and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate.
Molecular Properties
| Compound Name | 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate |
| PubChem CID | 70686348 |
| Molecular Formula | C13H15N3O8S2 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate |
| SMILES | O=c1ccn(COCCOS(=O)(=O)NS(=O)(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O8S2/c17-12-6-7-16(13(18)14-12)10-23-8-9-24-26(21,22)15-25(19,20)11-4-2-1-3-5-11/h1-7,15H,8-10H2,(H,14,17,18) |
| InChIKey | AXSNHVFPEWPAHC-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate?
The IUPAC name of 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate (CID 70686348) is 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate.
What is the SMILES notation for 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate?
The canonical SMILES for 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate is O=c1ccn(COCCOS(=O)(=O)NS(=O)(=O)c2ccccc2)c(=O)[nH]1.
What is the InChIKey of 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate?
The InChIKey is AXSNHVFPEWPAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O8S2/c17-12-6-7-16(13(18)14-12)10-23-8-9-24-26(21,22)15-25(19,20)11-4-2-1-3-5-11/h1-7,15H,8-10H2,(H,14,17,18).
What are the key properties of 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate?
2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate has a molecular weight of 405.41 g/mol, XLogP of -1.25, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxopyrimidin-1-yl)methoxy]ethyl N-(benzenesulfonyl)sulfamate is sourced from PubChem (CID 70686348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).