C31H29BrO8 — CID 70686563
(1E,6E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,7-bis(2,3-dimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 70686563) has the molecular formula C31H29BrO8 and a molecular weight of 609.47 g/mol. Its IUPAC name is (1E,6E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,7-bis(2,3-dimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,7-bis(2,3-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 70686563 |
| Molecular Formula | C31H29BrO8 |
| Molecular Weight | 609.47 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | (1E,6E)-4-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1,7-bis(2,3-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=C(C(=O)/C=C/c2cccc(OC)c2OC)C(=O)/C=C/c2cccc(OC)c2OC)cc(Br)c1O |
| InChI | InChI=1S/C31H29BrO8/c1-36-26-10-6-8-20(30(26)39-4)12-14-24(33)22(16-19-17-23(32)29(35)28(18-19)38-3)25(34)15-13-21-9-7-11-27(37-2)31(21)40-5/h6-18,35H,1-5H3/b14-12+,15-13+ |
| InChIKey | GJLRQCQZYONLSG-QUMQEAAQSA-N |
| XLogP | 6.15 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.47 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|