About 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate
2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (PubChem CID 70686583) has the molecular formula C19H16O8
and a molecular weight of 372.33 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| PubChem CID | 70686583 |
| Molecular Formula | C19H16O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C(OCCOCCO)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C19H16O8/c20-4-5-26-6-7-27-19(25)10-8-12-16(14(22)9-10)18(24)15-11(17(12)23)2-1-3-13(15)21/h1-3,8-9,20-22H,4-7H2 |
| InChIKey | HIGKJUXIOUJULQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate (CID 70686583) is 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate is O=C(OCCOCCO)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
The InChIKey is HIGKJUXIOUJULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O8/c20-4-5-26-6-7-27-19(25)10-8-12-16(14(22)9-10)18(24)15-11(17(12)23)2-1-3-13(15)21/h1-3,8-9,20-22H,4-7H2.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate?
2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate has a molecular weight of 372.33 g/mol, XLogP of 1.04, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylate is sourced from PubChem (CID 70686583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).