C24H36O5 — CID 70686598
methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20,22-trihydroxy-21-methyldocosa-4,8,10,12,16,18-hexaenoate (PubChem CID 70686598) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20,22-trihydroxy-21-methyldocosa-4,8,10,12,16,18-hexaenoate.
| Compound Name | methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20,22-trihydroxy-21-methyldocosa-4,8,10,12,16,18-hexaenoate |
|---|---|
| PubChem CID | 70686598 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20,22-trihydroxy-21-methyldocosa-4,8,10,12,16,18-hexaenoate |
| SMILES | COC(=O)CC/C=C/[C@@H](O)C/C=C/C=C/C=C/CC/C=C/C=C/[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C24H36O5/c1-21(20-25)23(27)18-13-11-9-7-5-3-4-6-8-10-12-16-22(26)17-14-15-19-24(28)29-2/h3-4,6,8-14,17-18,21-23,25-27H,5,7,15-16,19-20H2,1-2H3/b4-3+,8-6+,11-9+,12-10+,17-14+,18-13+/t21-,22-,23+/m0/s1 |
| InChIKey | TUNKITZONCPWBB-XRSCQFEHSA-N |
| XLogP | 3.80 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|