C32H44O6 — CID 70686599
methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20-dihydroxy-22-[(4-methoxyphenyl)methoxy]-21-methyldocosa-4,8,10,12,16,18-hexaenoate (PubChem CID 70686599) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20-dihydroxy-22-[(4-methoxyphenyl)methoxy]-21-methyldocosa-4,8,10,12,16,18-hexaenoate.
| Compound Name | methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20-dihydroxy-22-[(4-methoxyphenyl)methoxy]-21-methyldocosa-4,8,10,12,16,18-hexaenoate |
|---|---|
| PubChem CID | 70686599 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | methyl (4E,6S,8E,10E,12E,16E,18E,20R,21S)-6,20-dihydroxy-22-[(4-methoxyphenyl)methoxy]-21-methyldocosa-4,8,10,12,16,18-hexaenoate |
| SMILES | COC(=O)CC/C=C/[C@@H](O)C/C=C/C=C/C=C/CC/C=C/C=C/[C@@H](O)[C@@H](C)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C32H44O6/c1-27(25-38-26-28-21-23-30(36-2)24-22-28)31(34)19-14-12-10-8-6-4-5-7-9-11-13-17-29(33)18-15-16-20-32(35)37-3/h4-5,7,9-15,18-19,21-24,27,29,31,33-34H,6,8,16-17,20,25-26H2,1-3H3/b5-4+,9-7+,12-10+,13-11+,18-15+,19-14+/t27-,29-,31+/m0/s1 |
| InChIKey | FFYIFXAGLSHJRZ-XYDXQOJKSA-N |
| XLogP | 6.03 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|