C28H37NO7 — CID 70686691
7-ethyl-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one (PubChem CID 70686691) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is 7-ethyl-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one.
| Compound Name | 7-ethyl-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 70686691 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 7-ethyl-2,4-bis(3,4,5-trimethoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-one |
| SMILES | CCC1CC2C(=O)C(C1)C(c1cc(OC)c(OC)c(OC)c1)NC2c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C28H37NO7/c1-8-15-9-18-24(16-11-20(31-2)27(35-6)21(12-16)32-3)29-25(19(10-15)26(18)30)17-13-22(33-4)28(36-7)23(14-17)34-5/h11-15,18-19,24-25,29H,8-10H2,1-7H3 |
| InChIKey | RLXUUUQZGCNZSM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |