C22H21F6N3O3 — CID 70686722
(3R)-3-amino-1-[4-[4-(trifluoromethoxy)benzoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 70686722) has the molecular formula C22H21F6N3O3 and a molecular weight of 489.42 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-[4-(trifluoromethoxy)benzoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | (3R)-3-amino-1-[4-[4-(trifluoromethoxy)benzoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 70686722 |
| Molecular Formula | C22H21F6N3O3 |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | (3R)-3-amino-1-[4-[4-(trifluoromethoxy)benzoyl]piperazin-1-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | N[C@@H](CC(=O)N1CCN(C(=O)c2ccc(OC(F)(F)F)cc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C22H21F6N3O3/c23-17-12-19(25)18(24)10-14(17)9-15(29)11-20(32)30-5-7-31(8-6-30)21(33)13-1-3-16(4-2-13)34-22(26,27)28/h1-4,10,12,15H,5-9,11,29H2/t15-/m1/s1 |
| InChIKey | BNVVNCVXADUCNT-OAHLLOKOSA-N |
| XLogP | 3.25 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|