C38H42N4O4 — CID 70686725
2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-5-[3-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole (PubChem CID 70686725) has the molecular formula C38H42N4O4 and a molecular weight of 618.78 g/mol. Its IUPAC name is 2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-5-[3-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole.
| Compound Name | 2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-5-[3-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 70686725 |
| Molecular Formula | C38H42N4O4 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | 2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-5-[3-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1,3-oxazol-5-yl]phenyl]-1,3-oxazole |
| SMILES | c1cc(-c2cnc(-c3ccc(OCCCN4CCCC4)cc3)o2)cc(-c2cnc(-c3ccc(OCCCN4CCCC4)cc3)o2)c1 |
| InChI | InChI=1S/C38H42N4O4/c1-2-19-41(18-1)22-6-24-43-33-14-10-29(11-15-33)37-39-27-35(45-37)31-8-5-9-32(26-31)36-28-40-38(46-36)30-12-16-34(17-13-30)44-25-7-23-42-20-3-4-21-42/h5,8-17,26-28H,1-4,6-7,18-25H2 |
| InChIKey | HNLMFVAIPGXKMI-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 77.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|