C18H11NO6S — CID 70686786
dimethyl 4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate (PubChem CID 70686786) has the molecular formula C18H11NO6S and a molecular weight of 369.35 g/mol. Its IUPAC name is dimethyl 4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate.
| Compound Name | dimethyl 4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate |
|---|---|
| PubChem CID | 70686786 |
| Molecular Formula | C18H11NO6S |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | dimethyl 4,11-dioxo-[1]benzothiolo[6,5-b]indolizine-2,10-dicarboxylate |
| SMILES | COC(=O)c1cc2c(s1)C(=O)c1c(C(=O)OC)c3ccccn3c1C2=O |
| InChI | InChI=1S/C18H11NO6S/c1-24-17(22)10-7-8-14(20)13-12(15(21)16(8)26-10)11(18(23)25-2)9-5-3-4-6-19(9)13/h3-7H,1-2H3 |
| InChIKey | XRKBYNCCDONEGH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|