C22H29N9O3S — CID 70686957
5-[2-[(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)methyl]-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]pyrimidin-2-amine (PubChem CID 70686957) has the molecular formula C22H29N9O3S and a molecular weight of 499.60 g/mol. Its IUPAC name is 5-[2-[(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)methyl]-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]pyrimidin-2-amine.
| Compound Name | 5-[2-[(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)methyl]-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 70686957 |
| Molecular Formula | C22H29N9O3S |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 5-[2-[(5-methylsulfonyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)methyl]-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CC2CN(Cc3cn4cc(-c5cnc(N)nc5)nc(N5CCOCC5)c4n3)CC2C1 |
| InChI | InChI=1S/C22H29N9O3S/c1-35(32,33)31-10-16-8-28(9-17(16)11-31)12-18-13-30-14-19(15-6-24-22(23)25-7-15)27-21(20(30)26-18)29-2-4-34-5-3-29/h6-7,13-14,16-17H,2-5,8-12H2,1H3,(H2,23,24,25) |
| InChIKey | JGMCCTDJMQSGDC-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |