C27H34O6 — CID 70687013
(3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(4-hydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one (PubChem CID 70687013) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(4-hydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one.
| Compound Name | (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(4-hydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 70687013 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (3E,4S)-3-[2-[(4aR,6aS,7R,10aS,10bR)-3-(4-hydroxyphenyl)-6a,10b-dimethyl-8-methylidene-1,4a,5,6,7,9,10,10a-octahydronaphtho[2,1-d][1,3]dioxin-7-yl]ethylidene]-4-hydroxyoxolan-2-one |
| SMILES | C=C1CC[C@@H]2[C@]3(C)COC(c4ccc(O)cc4)O[C@@H]3CC[C@@]2(C)[C@@H]1C/C=C1/C(=O)OC[C@H]1O |
| InChI | InChI=1S/C27H34O6/c1-16-4-11-22-26(2,20(16)10-9-19-21(29)14-31-24(19)30)13-12-23-27(22,3)15-32-25(33-23)17-5-7-18(28)8-6-17/h5-9,20-23,25,28-29H,1,4,10-15H2,2-3H3/b19-9+/t20-,21-,22+,23-,25?,26+,27+/m1/s1 |
| InChIKey | VRFBIBCMJPRCGB-AVQIQYFCSA-N |
| XLogP | 4.43 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|