About (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride
(3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride (PubChem CID 70687132) has the molecular formula C13H20ClN3
and a molecular weight of 253.78 g/mol. Its IUPAC name is (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride.
Molecular Properties
| Compound Name | (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride |
| PubChem CID | 70687132 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride |
| SMILES | Cc1nc(C)c([C@@H]2CN3CCC2C3)nc1C.Cl |
| InChI | InChI=1S/C13H19N3.ClH/c1-8-9(2)15-13(10(3)14-8)12-7-16-5-4-11(12)6-16;/h11-12H,4-7H2,1-3H3;1H/t11?,12-;/m1./s1 |
| InChIKey | JTLXCTWLWVXACE-ALGPSANZSA-N |
| XLogP | 2.24 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride?
The IUPAC name of (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride (CID 70687132) is (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride.
What is the SMILES notation for (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride?
The canonical SMILES for (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride is Cc1nc(C)c([C@@H]2CN3CCC2C3)nc1C.Cl.
What is the InChIKey of (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride?
The InChIKey is JTLXCTWLWVXACE-ALGPSANZSA-N. The full InChI is InChI=1S/C13H19N3.ClH/c1-8-9(2)15-13(10(3)14-8)12-7-16-5-4-11(12)6-16;/h11-12H,4-7H2,1-3H3;1H/t11?,12-;/m1./s1.
What are the key properties of (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride?
(3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride has a molecular weight of 253.78 g/mol, XLogP of 2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3,5,6-trimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane;hydrochloride is sourced from PubChem (CID 70687132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).