C20H21ClN2O3 — CID 70687188
2-[4-(1,3-benzodioxol-5-yl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol (PubChem CID 70687188) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
|---|---|
| PubChem CID | 70687188 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-2-propan-2-yl-1,2,5,6-tetrahydropyrimidin-6-yl]-4-chlorophenol |
| SMILES | CC(C)C1N=C(c2ccc3c(c2)OCO3)CC(c2cc(Cl)ccc2O)N1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-11(2)20-22-15(12-3-6-18-19(7-12)26-10-25-18)9-16(23-20)14-8-13(21)4-5-17(14)24/h3-8,11,16,20,23-24H,9-10H2,1-2H3 |
| InChIKey | SRVKWLXVSOAVPE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|