C10H21N3S — CID 706873
(5S)-5-ethyl-5-methyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione (PubChem CID 706873) has the molecular formula C10H21N3S and a molecular weight of 215.37 g/mol. Its IUPAC name is (5S)-5-ethyl-5-methyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione.
| Compound Name | (5S)-5-ethyl-5-methyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 706873 |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (5S)-5-ethyl-5-methyl-2-(3-methylbutyl)-1,2,4-triazolidine-3-thione |
| SMILES | CC[C@@]1(C)NC(=S)N(CCC(C)C)N1 |
| InChI | InChI=1S/C10H21N3S/c1-5-10(4)11-9(14)13(12-10)7-6-8(2)3/h8,12H,5-7H2,1-4H3,(H,11,14)/t10-/m0/s1 |
| InChIKey | SZLPPHMQUGYSKB-JTQLQIEISA-N |
| XLogP | 1.85 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|