C23H30F2N2O2 — CID 70687441
(2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-N-hydroxyhexanamide (PubChem CID 70687441) has the molecular formula C23H30F2N2O2 and a molecular weight of 404.50 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-N-hydroxyhexanamide.
| Compound Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 70687441 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (2S)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-6-[[(1R)-1-(4-fluorophenyl)ethyl]amino]-N-hydroxyhexanamide |
| SMILES | Cc1cc(C[C@H](CCCCN[C@H](C)c2ccc(F)cc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C23H30F2N2O2/c1-15-12-18(13-16(2)22(15)25)14-20(23(28)27-29)6-4-5-11-26-17(3)19-7-9-21(24)10-8-19/h7-10,12-13,17,20,26,29H,4-6,11,14H2,1-3H3,(H,27,28)/t17-,20+/m1/s1 |
| InChIKey | ZMHAKBVPPHBHEE-XLIONFOSSA-N |
| XLogP | 4.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|