About 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole
8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole (PubChem CID 70687530) has the molecular formula C20H16BrF3N2
and a molecular weight of 421.26 g/mol. Its IUPAC name is 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole.
Molecular Properties
| Compound Name | 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole |
| PubChem CID | 70687530 |
| Molecular Formula | C20H16BrF3N2 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole |
| SMILES | CC1(C)Cc2cnn(-c3ccc(C(F)(F)F)cc3)c2-c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H16BrF3N2/c1-19(2)10-12-11-25-26(15-6-3-13(4-7-15)20(22,23)24)18(12)16-9-14(21)5-8-17(16)19/h3-9,11H,10H2,1-2H3 |
| InChIKey | MYQSTORMTCKFRZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole?
The IUPAC name of 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole (CID 70687530) is 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole.
What is the SMILES notation for 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole?
The canonical SMILES for 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole is CC1(C)Cc2cnn(-c3ccc(C(F)(F)F)cc3)c2-c2cc(Br)ccc21.
What is the InChIKey of 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole?
The InChIKey is MYQSTORMTCKFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16BrF3N2/c1-19(2)10-12-11-25-26(15-6-3-13(4-7-15)20(22,23)24)18(12)16-9-14(21)5-8-17(16)19/h3-9,11H,10H2,1-2H3.
What are the key properties of 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole?
8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole has a molecular weight of 421.26 g/mol, XLogP of 6.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5,5-dimethyl-1-[4-(trifluoromethyl)phenyl]-4H-benzo[g]indazole is sourced from PubChem (CID 70687530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).