C24H26NO4+ — CID 70687580
17-methoxy-16-pentoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 70687580) has the molecular formula C24H26NO4+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 17-methoxy-16-pentoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 17-methoxy-16-pentoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 70687580 |
| Molecular Formula | C24H26NO4+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 17-methoxy-16-pentoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | CCCCCOc1c(OC)ccc2cc3[n+](cc12)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C24H26NO4/c1-3-4-5-10-27-24-19-14-25-9-8-17-12-22-23(29-15-28-22)13-18(17)20(25)11-16(19)6-7-21(24)26-2/h6-7,11-14H,3-5,8-10,15H2,1-2H3/q+1 |
| InChIKey | QPJKBABGLJDUQY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|