C24H26N8O3 — CID 70687748
1-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]-3-pyrrolidin-3-ylurea (PubChem CID 70687748) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]-3-pyrrolidin-3-ylurea.
| Compound Name | 1-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]-3-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 70687748 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[3-[[6-(3,4-dimethoxyphenyl)-7H-purin-2-yl]amino]phenyl]-3-pyrrolidin-3-ylurea |
| SMILES | COc1ccc(-c2nc(Nc3cccc(NC(=O)NC4CCNC4)c3)nc3nc[nH]c23)cc1OC |
| InChI | InChI=1S/C24H26N8O3/c1-34-18-7-6-14(10-19(18)35-2)20-21-22(27-13-26-21)32-23(31-20)28-15-4-3-5-16(11-15)29-24(33)30-17-8-9-25-12-17/h3-7,10-11,13,17,25H,8-9,12H2,1-2H3,(H2,29,30,33)(H2,26,27,28,31,32) |
| InChIKey | ONFLWGTUTYRLIL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 138.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |