C17H21BN2O3 — CID 70687769
2-methoxy-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine (PubChem CID 70687769) has the molecular formula C17H21BN2O3 and a molecular weight of 312.18 g/mol. Its IUPAC name is 2-methoxy-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine.
| Compound Name | 2-methoxy-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 70687769 |
| Molecular Formula | C17H21BN2O3 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-methoxy-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrimidine |
| SMILES | COc1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cn1 |
| InChI | InChI=1S/C17H21BN2O3/c1-16(2)17(3,4)23-18(22-16)14-8-6-12(7-9-14)13-10-19-15(21-5)20-11-13/h6-11H,1-5H3 |
| InChIKey | SNIVBTUCLHQIOL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|