C21H18BrN3OS — CID 70687827
3-(4-methoxyphenyl)-N,2-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide (PubChem CID 70687827) has the molecular formula C21H18BrN3OS and a molecular weight of 440.37 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N,2-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide.
| Compound Name | 3-(4-methoxyphenyl)-N,2-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
|---|---|
| PubChem CID | 70687827 |
| Molecular Formula | C21H18BrN3OS |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 3-(4-methoxyphenyl)-N,2-diphenyl-1,2,4-thiadiazol-5-imine;hydrobromide |
| SMILES | Br.COc1ccc(-c2n/c(=N/c3ccccc3)sn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3OS.BrH/c1-25-19-14-12-16(13-15-19)20-23-21(22-17-8-4-2-5-9-17)26-24(20)18-10-6-3-7-11-18;/h2-15H,1H3;1H/b22-21-; |
| InChIKey | LXBOJEIRSAJLOF-SVXKRPBISA-N |
| XLogP | 5.42 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|