C26H28N4O — CID 70687951
3-methyl-2-[4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]phenyl]-1H-quinolin-4-one (PubChem CID 70687951) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-methyl-2-[4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]phenyl]-1H-quinolin-4-one.
| Compound Name | 3-methyl-2-[4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]phenyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 70687951 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-methyl-2-[4-[1-(2-piperidin-1-ylethyl)pyrazol-4-yl]phenyl]-1H-quinolin-4-one |
| SMILES | Cc1c(-c2ccc(-c3cnn(CCN4CCCCC4)c3)cc2)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C26H28N4O/c1-19-25(28-24-8-4-3-7-23(24)26(19)31)21-11-9-20(10-12-21)22-17-27-30(18-22)16-15-29-13-5-2-6-14-29/h3-4,7-12,17-18H,2,5-6,13-16H2,1H3,(H,28,31) |
| InChIKey | JHPSWZZHCSPUFO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |