C32H32N3O5P — CID 70687983
(2S,3S,4S,5S,6R)-3-azido-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide (PubChem CID 70687983) has the molecular formula C32H32N3O5P and a molecular weight of 569.60 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-3-azido-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide.
| Compound Name | (2S,3S,4S,5S,6R)-3-azido-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 70687983 |
| Molecular Formula | C32H32N3O5P |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | (2S,3S,4S,5S,6R)-3-azido-2-phenyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-1,2λ5-oxaphosphinane 2-oxide |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[P@@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C32H32N3O5P/c33-35-34-32-31(39-23-27-17-9-3-10-18-27)30(38-22-26-15-7-2-8-16-26)29(24-37-21-25-13-5-1-6-14-25)40-41(32,36)28-19-11-4-12-20-28/h1-20,29-32H,21-24H2/t29-,30-,31+,32+,41+/m1/s1 |
| InChIKey | NBFWMJRCAJCJEF-ZXPFLCMZSA-N |
| XLogP | 7.01 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|