C20H26N2O2S — CID 70688007
(1R,2R,9S,17S)-5-(thiophene-2-carbonyl)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one (PubChem CID 70688007) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is (1R,2R,9S,17S)-5-(thiophene-2-carbonyl)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one.
| Compound Name | (1R,2R,9S,17S)-5-(thiophene-2-carbonyl)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
|---|---|
| PubChem CID | 70688007 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (1R,2R,9S,17S)-5-(thiophene-2-carbonyl)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| SMILES | O=C(c1cccs1)C1CC[C@@H]2[C@H]3CCCN4CCC[C@@H](CN2C1=O)[C@@H]34 |
| InChI | InChI=1S/C20H26N2O2S/c23-19(17-6-3-11-25-17)15-7-8-16-14-5-2-10-21-9-1-4-13(18(14)21)12-22(16)20(15)24/h3,6,11,13-16,18H,1-2,4-5,7-10,12H2/t13-,14+,15?,16+,18-/m0/s1 |
| InChIKey | OOHTXEVODQRYSL-RQMLTGHISA-N |
| XLogP | 3.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|