C17H24O2 — CID 7068804
(2R,3aS,9bR)-4,4-dimethyl-2-(2-methylpropyl)-2,3,3a,9b-tetrahydrofuro[3,2-c]chromene (PubChem CID 7068804) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (2R,3aS,9bR)-4,4-dimethyl-2-(2-methylpropyl)-2,3,3a,9b-tetrahydrofuro[3,2-c]chromene.
| Compound Name | (2R,3aS,9bR)-4,4-dimethyl-2-(2-methylpropyl)-2,3,3a,9b-tetrahydrofuro[3,2-c]chromene |
|---|---|
| PubChem CID | 7068804 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (2R,3aS,9bR)-4,4-dimethyl-2-(2-methylpropyl)-2,3,3a,9b-tetrahydrofuro[3,2-c]chromene |
| SMILES | CC(C)C[C@@H]1C[C@H]2[C@@H](O1)c1ccccc1OC2(C)C |
| InChI | InChI=1S/C17H24O2/c1-11(2)9-12-10-14-16(18-12)13-7-5-6-8-15(13)19-17(14,3)4/h5-8,11-12,14,16H,9-10H2,1-4H3/t12-,14+,16+/m1/s1 |
| InChIKey | SAYNSLVBCCNEBK-INWMFGNUSA-N |
| XLogP | 4.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |