C19H39F2NO2 — CID 70688117
(2S,3S,5S)-11,11-difluoro-2-(methylamino)octadecane-3,5-diol (PubChem CID 70688117) has the molecular formula C19H39F2NO2 and a molecular weight of 351.52 g/mol. Its IUPAC name is (2S,3S,5S)-11,11-difluoro-2-(methylamino)octadecane-3,5-diol.
| Compound Name | (2S,3S,5S)-11,11-difluoro-2-(methylamino)octadecane-3,5-diol |
|---|---|
| PubChem CID | 70688117 |
| Molecular Formula | C19H39F2NO2 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | (2S,3S,5S)-11,11-difluoro-2-(methylamino)octadecane-3,5-diol |
| SMILES | CCCCCCCC(F)(F)CCCCC[C@H](O)C[C@H](O)[C@H](C)NC |
| InChI | InChI=1S/C19H39F2NO2/c1-4-5-6-7-10-13-19(20,21)14-11-8-9-12-17(23)15-18(24)16(2)22-3/h16-18,22-24H,4-15H2,1-3H3/t16-,17-,18-/m0/s1 |
| InChIKey | XZFIBMQLVLLXQY-BZSNNMDCSA-N |
| XLogP | 4.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|