About (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate
(1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate (PubChem CID 70688424) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate.
Molecular Properties
| Compound Name | (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate |
| PubChem CID | 70688424 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate |
| SMILES | C=CCCC1=NCC(OC(C)=O)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C17H21NO4/c1-5-6-7-14-12-8-15(20-3)16(21-4)9-13(12)17(10-18-14)22-11(2)19/h5,8-9,17H,1,6-7,10H2,2-4H3 |
| InChIKey | HLWOHIBSDZNSEO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate?
The IUPAC name of (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate (CID 70688424) is (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate.
What is the SMILES notation for (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate?
The canonical SMILES for (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate is C=CCCC1=NCC(OC(C)=O)c2cc(OC)c(OC)cc21.
What is the InChIKey of (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate?
The InChIKey is HLWOHIBSDZNSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-5-6-7-14-12-8-15(20-3)16(21-4)9-13(12)17(10-18-14)22-11(2)19/h5,8-9,17H,1,6-7,10H2,2-4H3.
What are the key properties of (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate?
(1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate has a molecular weight of 303.36 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-but-3-enyl-6,7-dimethoxy-3,4-dihydroisoquinolin-4-yl) acetate is sourced from PubChem (CID 70688424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).