About N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide
N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide (PubChem CID 7068853) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide |
| PubChem CID | 7068853 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)[C@H]1CC=C(C)/C(=N/O)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-8-5-6-10(7-11(8)14-16)12(3,4)13-9(2)15/h5,10,16H,6-7H2,1-4H3,(H,13,15)/b14-11+/t10-/m0/s1 |
| InChIKey | JIQLBNCILJHELB-AYDSOBSRSA-N |
| XLogP | 2.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide?
The IUPAC name of N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide (CID 7068853) is N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide.
What is the SMILES notation for N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide?
The canonical SMILES for N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide is CC(=O)NC(C)(C)[C@H]1CC=C(C)/C(=N/O)C1.
What is the InChIKey of N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide?
The InChIKey is JIQLBNCILJHELB-AYDSOBSRSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-8-5-6-10(7-11(8)14-16)12(3,4)13-9(2)15/h5,10,16H,6-7H2,1-4H3,(H,13,15)/b14-11+/t10-/m0/s1.
What are the key properties of N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide?
N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide has a molecular weight of 224.30 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1S,5E)-5-hydroxyimino-4-methylcyclohex-3-en-1-yl]propan-2-yl]acetamide is sourced from PubChem (CID 7068853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).