About 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol
1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol (PubChem CID 70688547) has the molecular formula C25H29NOS
and a molecular weight of 391.58 g/mol. Its IUPAC name is 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol |
| PubChem CID | 70688547 |
| Molecular Formula | C25H29NOS |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol |
| SMILES | Cc1cc(C)cc(SCC(O)CN(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H29NOS/c1-20-13-21(2)15-25(14-20)28-19-24(27)18-26(16-22-9-5-3-6-10-22)17-23-11-7-4-8-12-23/h3-15,24,27H,16-19H2,1-2H3 |
| InChIKey | CJQGFTQAVBSDOK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol?
The IUPAC name of 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol (CID 70688547) is 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol.
What is the SMILES notation for 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol?
The canonical SMILES for 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol is Cc1cc(C)cc(SCC(O)CN(Cc2ccccc2)Cc2ccccc2)c1.
What is the InChIKey of 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol?
The InChIKey is CJQGFTQAVBSDOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NOS/c1-20-13-21(2)15-25(14-20)28-19-24(27)18-26(16-22-9-5-3-6-10-22)17-23-11-7-4-8-12-23/h3-15,24,27H,16-19H2,1-2H3.
What are the key properties of 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol?
1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol has a molecular weight of 391.58 g/mol, XLogP of 5.46, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dibenzylamino)-3-(3,5-dimethylphenyl)sulfanylpropan-2-ol is sourced from PubChem (CID 70688547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).