C13H17N3O2S2 — CID 70688600
[(E)-(1,1-dioxo-6-propan-2-yl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea (PubChem CID 70688600) has the molecular formula C13H17N3O2S2 and a molecular weight of 311.43 g/mol. Its IUPAC name is [(E)-(1,1-dioxo-6-propan-2-yl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea.
| Compound Name | [(E)-(1,1-dioxo-6-propan-2-yl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 70688600 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [(E)-(1,1-dioxo-6-propan-2-yl-2,3-dihydrothiochromen-4-ylidene)amino]thiourea |
| SMILES | CC(C)c1ccc2c(c1)/C(=N/NC(N)=S)CCS2(=O)=O |
| InChI | InChI=1S/C13H17N3O2S2/c1-8(2)9-3-4-12-10(7-9)11(15-16-13(14)19)5-6-20(12,17)18/h3-4,7-8H,5-6H2,1-2H3,(H3,14,16,19)/b15-11+ |
| InChIKey | CWSZEIOCDFZMEQ-RVDMUPIBSA-N |
| XLogP | 1.52 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|