C31H30O8 — CID 70688684
(1E,6E)-1,7-bis(2,5-dimethoxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione (PubChem CID 70688684) has the molecular formula C31H30O8 and a molecular weight of 530.57 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(2,5-dimethoxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(2,5-dimethoxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 70688684 |
| Molecular Formula | C31H30O8 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (1E,6E)-1,7-bis(2,5-dimethoxyphenyl)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)C(=Cc2ccc(OC)c(O)c2)C(=O)/C=C/c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C31H30O8/c1-35-23-9-14-29(37-3)21(18-23)7-11-26(32)25(16-20-6-13-31(39-5)28(34)17-20)27(33)12-8-22-19-24(36-2)10-15-30(22)38-4/h6-19,34H,1-5H3/b11-7+,12-8+ |
| InChIKey | XGEUYUZLQUCOTB-MKICQXMISA-N |
| XLogP | 5.38 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|