C14H12Cl2N4O2 — CID 706887
7-[(3,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 706887) has the molecular formula C14H12Cl2N4O2 and a molecular weight of 339.18 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 706887 |
| Molecular Formula | C14H12Cl2N4O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2Cc2ccc(Cl)c(Cl)c2)n(C)c1=O |
| InChI | InChI=1S/C14H12Cl2N4O2/c1-18-12-11(13(21)19(2)14(18)22)20(7-17-12)6-8-3-4-9(15)10(16)5-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | XTWQDSYRWIYKHT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |