C25H26N4S — CID 70688791
(3R)-3-(5-phenyl-1H-imidazol-2-yl)-1-(thian-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 70688791) has the molecular formula C25H26N4S and a molecular weight of 414.58 g/mol. Its IUPAC name is (3R)-3-(5-phenyl-1H-imidazol-2-yl)-1-(thian-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (3R)-3-(5-phenyl-1H-imidazol-2-yl)-1-(thian-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 70688791 |
| Molecular Formula | C25H26N4S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (3R)-3-(5-phenyl-1H-imidazol-2-yl)-1-(thian-4-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2cnc([C@H]3Cc4c([nH]c5ccccc45)C(C4CCSCC4)N3)[nH]2)cc1 |
| InChI | InChI=1S/C25H26N4S/c1-2-6-16(7-3-1)22-15-26-25(29-22)21-14-19-18-8-4-5-9-20(18)27-24(19)23(28-21)17-10-12-30-13-11-17/h1-9,15,17,21,23,27-28H,10-14H2,(H,26,29)/t21-,23?/m1/s1 |
| InChIKey | LRRPBUZCJGWMNN-FKHAVUOCSA-N |
| XLogP | 5.63 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|