C21H21F3N4O — CID 70688809
4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile (PubChem CID 70688809) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70688809 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2CCN(C(=O)C[C@H](N)Cc3cc(F)c(F)cc3F)CC2)cc1 |
| InChI | InChI=1S/C21H21F3N4O/c22-18-12-20(24)19(23)10-15(18)9-16(26)11-21(29)28-7-5-27(6-8-28)17-3-1-14(13-25)2-4-17/h1-4,10,12,16H,5-9,11,26H2/t16-/m1/s1 |
| InChIKey | FBUIQDNORXDEME-MRXNPFEDSA-N |
| XLogP | 2.58 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|