C21H16F3N3O5S2 — CID 70688836
3,4-dihydro-1H-isoquinolin-2-yl-[2-(4-methylsulfonyl-3-nitrophenyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone (PubChem CID 70688836) has the molecular formula C21H16F3N3O5S2 and a molecular weight of 511.50 g/mol. Its IUPAC name is 3,4-dihydro-1H-isoquinolin-2-yl-[2-(4-methylsulfonyl-3-nitrophenyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone.
| Compound Name | 3,4-dihydro-1H-isoquinolin-2-yl-[2-(4-methylsulfonyl-3-nitrophenyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 70688836 |
| Molecular Formula | C21H16F3N3O5S2 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 3,4-dihydro-1H-isoquinolin-2-yl-[2-(4-methylsulfonyl-3-nitrophenyl)-4-(trifluoromethyl)-1,3-thiazol-5-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(-c2nc(C(F)(F)F)c(C(=O)N3CCc4ccccc4C3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16F3N3O5S2/c1-34(31,32)16-7-6-13(10-15(16)27(29)30)19-25-18(21(22,23)24)17(33-19)20(28)26-9-8-12-4-2-3-5-14(12)11-26/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | SWTPJUPXZUBXRV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|