About N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide
N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 70688908) has the molecular formula C12H13N3O3S2
and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 70688908 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2ccc(S(N)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C12H13N3O3S2/c1-7-11(19-12(14-7)15-8(2)16)9-3-5-10(6-4-9)20(13,17)18/h3-6H,1-2H3,(H2,13,17,18)(H,14,15,16) |
| InChIKey | ZASMRPOKAYRYIC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide (CID 70688908) is N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(C)c(-c2ccc(S(N)(=O)=O)cc2)s1.
What is the InChIKey of N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is ZASMRPOKAYRYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O3S2/c1-7-11(19-12(14-7)15-8(2)16)9-3-5-10(6-4-9)20(13,17)18/h3-6H,1-2H3,(H2,13,17,18)(H,14,15,16).
What are the key properties of N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide?
N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 311.39 g/mol, XLogP of 1.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-methyl-5-(4-sulfamoylphenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 70688908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).