About (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate
(1-butylnaphthalen-2-yl) N,N-dimethylcarbamate (PubChem CID 70688925) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate |
| PubChem CID | 70688925 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate |
| SMILES | CCCCc1c(OC(=O)N(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C17H21NO2/c1-4-5-9-15-14-10-7-6-8-13(14)11-12-16(15)20-17(19)18(2)3/h6-8,10-12H,4-5,9H2,1-3H3 |
| InChIKey | CSRKIQBQFVCYTJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate?
The IUPAC name of (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate (CID 70688925) is (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate.
What is the SMILES notation for (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate?
The canonical SMILES for (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate is CCCCc1c(OC(=O)N(C)C)ccc2ccccc12.
What is the InChIKey of (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate?
The InChIKey is CSRKIQBQFVCYTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-4-5-9-15-14-10-7-6-8-13(14)11-12-16(15)20-17(19)18(2)3/h6-8,10-12H,4-5,9H2,1-3H3.
What are the key properties of (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate?
(1-butylnaphthalen-2-yl) N,N-dimethylcarbamate has a molecular weight of 271.36 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-butylnaphthalen-2-yl) N,N-dimethylcarbamate is sourced from PubChem (CID 70688925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).