C13H24N2O20S4 — CID 70689049
[2-[ethyl-[2-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-trisulfooxyoxan-2-yl]methylamino]-2-oxoethyl]amino]-2-oxoethyl] hydrogen sulfate (PubChem CID 70689049) has the molecular formula C13H24N2O20S4 and a molecular weight of 656.60 g/mol. Its IUPAC name is [2-[ethyl-[2-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-trisulfooxyoxan-2-yl]methylamino]-2-oxoethyl]amino]-2-oxoethyl] hydrogen sulfate.
| Compound Name | [2-[ethyl-[2-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-trisulfooxyoxan-2-yl]methylamino]-2-oxoethyl]amino]-2-oxoethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 70689049 |
| Molecular Formula | C13H24N2O20S4 |
| Molecular Weight | 656.60 g/mol |
| Exact Mass | 655.98 |
| IUPAC Name | [2-[ethyl-[2-[[(2R,3R,4S,5S,6S)-6-methoxy-3,4,5-trisulfooxyoxan-2-yl]methylamino]-2-oxoethyl]amino]-2-oxoethyl] hydrogen sulfate |
| SMILES | CCN(CC(=O)NC[C@H]1O[C@H](OC)[C@@H](OS(=O)(=O)O)[C@@H](OS(=O)(=O)O)[C@@H]1OS(=O)(=O)O)C(=O)COS(=O)(=O)O |
| InChI | InChI=1S/C13H24N2O20S4/c1-3-15(9(17)6-31-36(18,19)20)5-8(16)14-4-7-10(33-37(21,22)23)11(34-38(24,25)26)12(13(30-2)32-7)35-39(27,28)29/h7,10-13H,3-6H2,1-2H3,(H,14,16)(H,18,19,20)(H,21,22,23)(H,24,25,26)(H,27,28,29)/t7-,10-,11+,12+,13+/m1/s1 |
| InChIKey | FVJMURQKBFXSCC-DOXCMXCOSA-N |
| XLogP | -4.29 |
| TPSA | 322.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.60 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|