About 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine
2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine (PubChem CID 70689119) has the molecular formula C24H30N4O
and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine |
| PubChem CID | 70689119 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine |
| SMILES | Cc1c2cc(OCCN(C)C)ccc2nc2c1c1ccccc1n2CCN(C)C |
| InChI | InChI=1S/C24H30N4O/c1-17-20-16-18(29-15-14-27(4)5)10-11-21(20)25-24-23(17)19-8-6-7-9-22(19)28(24)13-12-26(2)3/h6-11,16H,12-15H2,1-5H3 |
| InChIKey | NJAGDFBMPZRKOJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine (CID 70689119) is 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine is Cc1c2cc(OCCN(C)C)ccc2nc2c1c1ccccc1n2CCN(C)C.
What is the InChIKey of 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine?
The InChIKey is NJAGDFBMPZRKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O/c1-17-20-16-18(29-15-14-27(4)5)10-11-21(20)25-24-23(17)19-8-6-7-9-22(19)28(24)13-12-26(2)3/h6-11,16H,12-15H2,1-5H3.
What are the key properties of 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine?
2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine has a molecular weight of 390.53 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(dimethylamino)ethoxy]-11-methylindolo[2,3-b]quinolin-6-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 70689119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).