C18H20O4 — CID 70689165
[(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4,6,7-tetrahydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate (PubChem CID 70689165) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4,6,7-tetrahydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate.
| Compound Name | [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4,6,7-tetrahydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate |
|---|---|
| PubChem CID | 70689165 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [(Z)-[(3aR,7aR)-7a-methyl-5-oxo-3a,4,6,7-tetrahydro-1-benzofuran-3-ylidene]-phenylmethyl] acetate |
| SMILES | CC(=O)O/C(=C1\CO[C@]2(C)CCC(=O)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C18H20O4/c1-12(19)22-17(13-6-4-3-5-7-13)15-11-21-18(2)9-8-14(20)10-16(15)18/h3-7,16H,8-11H2,1-2H3/b17-15+/t16-,18-/m1/s1 |
| InChIKey | YWBFVNYNLDUIAQ-RDBNGCDTSA-N |
| XLogP | 3.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|