About benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate
benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate (PubChem CID 70689279) has the molecular formula C29H21NO5S
and a molecular weight of 495.56 g/mol. Its IUPAC name is benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate.
Molecular Properties
| Compound Name | benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate |
| PubChem CID | 70689279 |
| Molecular Formula | C29H21NO5S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate |
| SMILES | Cc1csc2nc(Cc3ccc(C(=O)c4ccc(C(=O)OCc5ccccc5)cc4)cc3)oc(=O)c12 |
| InChI | InChI=1S/C29H21NO5S/c1-18-17-36-27-25(18)29(33)35-24(30-27)15-19-7-9-21(10-8-19)26(31)22-11-13-23(14-12-22)28(32)34-16-20-5-3-2-4-6-20/h2-14,17H,15-16H2,1H3 |
| InChIKey | BMQZZWPZAYRNRZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate?
The IUPAC name of benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate (CID 70689279) is benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate.
What is the SMILES notation for benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate?
The canonical SMILES for benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate is Cc1csc2nc(Cc3ccc(C(=O)c4ccc(C(=O)OCc5ccccc5)cc4)cc3)oc(=O)c12.
What is the InChIKey of benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate?
The InChIKey is BMQZZWPZAYRNRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21NO5S/c1-18-17-36-27-25(18)29(33)35-24(30-27)15-19-7-9-21(10-8-19)26(31)22-11-13-23(14-12-22)28(32)34-16-20-5-3-2-4-6-20/h2-14,17H,15-16H2,1H3.
What are the key properties of benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate?
benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate has a molecular weight of 495.56 g/mol, XLogP of 5.74, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[4-[(5-methyl-4-oxothieno[2,3-d][1,3]oxazin-2-yl)methyl]benzoyl]benzoate is sourced from PubChem (CID 70689279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).