C28H37ClN6 — CID 70689372
7-chloro-N-[3-[4-[3-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]amino]propyl]piperazin-1-yl]propyl]quinolin-4-amine (PubChem CID 70689372) has the molecular formula C28H37ClN6 and a molecular weight of 493.10 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-[3-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]amino]propyl]piperazin-1-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-[3-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]amino]propyl]piperazin-1-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 70689372 |
| Molecular Formula | C28H37ClN6 |
| Molecular Weight | 493.10 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 7-chloro-N-[3-[4-[3-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]amino]propyl]piperazin-1-yl]propyl]quinolin-4-amine |
| SMILES | Clc1ccc2c(NCCCN3CCN(CCCN[C@@H]4Cc5ccccc5CN4)CC3)ccnc2c1 |
| InChI | InChI=1S/C28H37ClN6/c29-24-7-8-25-26(9-12-31-27(25)20-24)30-10-3-13-34-15-17-35(18-16-34)14-4-11-32-28-19-22-5-1-2-6-23(22)21-33-28/h1-2,5-9,12,20,28,32-33H,3-4,10-11,13-19,21H2,(H,30,31)/t28-/m0/s1 |
| InChIKey | LPTCMGDBLJZDIZ-NDEPHWFRSA-N |
| XLogP | 3.96 |
| TPSA | 55.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|