C21H37NO4 — CID 70689429
(3S,5R)-1-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol (PubChem CID 70689429) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is (3S,5R)-1-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol.
| Compound Name | (3S,5R)-1-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 70689429 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | (3S,5R)-1-[5-(1-adamantylmethoxy)pentyl]piperidine-3,4,5-triol |
| SMILES | OC1[C@H](O)CN(CCCCCOCC23CC4CC(CC(C4)C2)C3)C[C@@H]1O |
| InChI | InChI=1S/C21H37NO4/c23-18-12-22(13-19(24)20(18)25)4-2-1-3-5-26-14-21-9-15-6-16(10-21)8-17(7-15)11-21/h15-20,23-25H,1-14H2/t15?,16?,17?,18-,19+,20?,21? |
| InChIKey | VWKORMGUKPBDIL-DQYSQJTOSA-N |
| XLogP | 1.79 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|