C14H10ClN3O4S — CID 70689540
1-(3-chlorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea (PubChem CID 70689540) has the molecular formula C14H10ClN3O4S and a molecular weight of 351.77 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea.
| Compound Name | 1-(3-chlorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 70689540 |
| Molecular Formula | C14H10ClN3O4S |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1,1,3-trioxo-1,2-benzothiazol-6-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1ccc2c(c1)S(=O)(=O)NC2=O |
| InChI | InChI=1S/C14H10ClN3O4S/c15-8-2-1-3-9(6-8)16-14(20)17-10-4-5-11-12(7-10)23(21,22)18-13(11)19/h1-7H,(H,18,19)(H2,16,17,20) |
| InChIKey | AWTUSQCNJGTEDT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |