C22H17N7O4S — CID 70689657
5-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-3-methyl-7-[(4-nitrophenyl)methyl]-[1,2]oxazolo[4,5-d]pyridazin-4-one (PubChem CID 70689657) has the molecular formula C22H17N7O4S and a molecular weight of 475.49 g/mol. Its IUPAC name is 5-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-3-methyl-7-[(4-nitrophenyl)methyl]-[1,2]oxazolo[4,5-d]pyridazin-4-one.
| Compound Name | 5-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-3-methyl-7-[(4-nitrophenyl)methyl]-[1,2]oxazolo[4,5-d]pyridazin-4-one |
|---|---|
| PubChem CID | 70689657 |
| Molecular Formula | C22H17N7O4S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 5-[(5-anilino-1,3,4-thiadiazol-2-yl)methyl]-3-methyl-7-[(4-nitrophenyl)methyl]-[1,2]oxazolo[4,5-d]pyridazin-4-one |
| SMILES | Cc1noc2c(Cc3ccc([N+](=O)[O-])cc3)nn(Cc3nnc(Nc4ccccc4)s3)c(=O)c12 |
| InChI | InChI=1S/C22H17N7O4S/c1-13-19-20(33-27-13)17(11-14-7-9-16(10-8-14)29(31)32)26-28(21(19)30)12-18-24-25-22(34-18)23-15-5-3-2-4-6-15/h2-10H,11-12H2,1H3,(H,23,25) |
| InChIKey | RHRCRBLQCAWGCP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|