About 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide
2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide (PubChem CID 70689692) has the molecular formula C31H23BrN2O2
and a molecular weight of 535.44 g/mol. Its IUPAC name is 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide.
Molecular Properties
| Compound Name | 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide |
| PubChem CID | 70689692 |
| Molecular Formula | C31H23BrN2O2 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)[n+]1ccn(-c2ccc(-c3cc4ccccc4o3)cc2)c1.[Br-] |
| InChI | InChI=1S/C31H23N2O2.BrH/c34-31(25-11-5-2-6-12-25)30(24-9-3-1-4-10-24)33-20-19-32(22-33)27-17-15-23(16-18-27)29-21-26-13-7-8-14-28(26)35-29;/h1-22,30H;1H/q+1;/p-1 |
| InChIKey | LDSVZESQLUOCAQ-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 39.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide?
The IUPAC name of 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide (CID 70689692) is 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide.
What is the SMILES notation for 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide?
The canonical SMILES for 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide is O=C(c1ccccc1)C(c1ccccc1)[n+]1ccn(-c2ccc(-c3cc4ccccc4o3)cc2)c1.[Br-].
What is the InChIKey of 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide?
The InChIKey is LDSVZESQLUOCAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C31H23N2O2.BrH/c34-31(25-11-5-2-6-12-25)30(24-9-3-1-4-10-24)33-20-19-32(22-33)27-17-15-23(16-18-27)29-21-26-13-7-8-14-28(26)35-29;/h1-22,30H;1H/q+1;/p-1.
What are the key properties of 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide?
2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide has a molecular weight of 535.44 g/mol, XLogP of 3.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(1-benzofuran-2-yl)phenyl]imidazol-1-ium-1-yl]-1,2-diphenylethanone bromide is sourced from PubChem (CID 70689692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).